C18H18F2N4O2S — CID 55862290
N-[4-(dimethylamino)-3,5-difluorophenyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 55862290) has the molecular formula C18H18F2N4O2S and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3,5-difluorophenyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 55862290 |
| Molecular Formula | C18H18F2N4O2S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | CN(C)c1c(F)cc(NC(=O)CCCc2nc(-c3cccs3)no2)cc1F |
| InChI | InChI=1S/C18H18F2N4O2S/c1-24(2)17-12(19)9-11(10-13(17)20)21-15(25)6-3-7-16-22-18(23-26-16)14-5-4-8-27-14/h4-5,8-10H,3,6-7H2,1-2H3,(H,21,25) |
| InChIKey | ZBKOIULEOXOAFX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|