C16H14IN3O2S — CID 38888106
N-(4-iodophenyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 38888106) has the molecular formula C16H14IN3O2S and a molecular weight of 439.28 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-(4-iodophenyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 38888106 |
| Molecular Formula | C16H14IN3O2S |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | N-(4-iodophenyl)-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | O=C(CCCc1nc(-c2cccs2)no1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H14IN3O2S/c17-11-6-8-12(9-7-11)18-14(21)4-1-5-15-19-16(20-22-15)13-3-2-10-23-13/h2-3,6-10H,1,4-5H2,(H,18,21) |
| InChIKey | GQYRBJAJBZOOHR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|