C18H19NO5S2 — CID 8506477
ethyl 4-[[2-[2-(thiophen-2-ylmethylsulfanyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 8506477) has the molecular formula C18H19NO5S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(thiophen-2-ylmethylsulfanyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-(thiophen-2-ylmethylsulfanyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 8506477 |
| Molecular Formula | C18H19NO5S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | ethyl 4-[[2-[2-(thiophen-2-ylmethylsulfanyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)CSCc2cccs2)cc1 |
| InChI | InChI=1S/C18H19NO5S2/c1-2-23-18(22)13-5-7-14(8-6-13)19-16(20)10-24-17(21)12-25-11-15-4-3-9-26-15/h3-9H,2,10-12H2,1H3,(H,19,20) |
| InChIKey | RGHWUPZRMGVCEK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |