C19H23NO3S2 — CID 8506483
[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate (PubChem CID 8506483) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate.
| Compound Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 8506483 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)COC(=O)CSCc1cccs1 |
| InChI | InChI=1S/C19H23NO3S2/c1-13(2)16-8-4-6-14(3)19(16)20-17(21)10-23-18(22)12-24-11-15-7-5-9-25-15/h4-9,13H,10-12H2,1-3H3,(H,20,21) |
| InChIKey | KDLFGYGTRBLWRD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |