C22H27NO3 — CID 7228079
[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (3R)-3-phenylbutanoate (PubChem CID 7228079) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (3R)-3-phenylbutanoate.
| Compound Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (3R)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7228079 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (3R)-3-phenylbutanoate |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)COC(=O)C[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-15(2)19-12-8-9-16(3)22(19)23-20(24)14-26-21(25)13-17(4)18-10-6-5-7-11-18/h5-12,15,17H,13-14H2,1-4H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | LLXJDTFDXFMBBF-QGZVFWFLSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |