C22H27NO4 — CID 7233331
[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate (PubChem CID 7233331) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate.
| Compound Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate |
|---|---|
| PubChem CID | 7233331 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl] (2R)-2-phenoxybutanoate |
| SMILES | CC[C@@H](Oc1ccccc1)C(=O)OCC(=O)Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C22H27NO4/c1-5-19(27-17-11-7-6-8-12-17)22(25)26-14-20(24)23-21-16(4)10-9-13-18(21)15(2)3/h6-13,15,19H,5,14H2,1-4H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | VSMLRKRLOIAOET-LJQANCHMSA-N |
| XLogP | 4.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |