C22H29NO3S — CID 7962575
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate (PubChem CID 7962575) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962575 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)COC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C22H29NO3S/c1-15(2)18-10-6-11-19(16(3)4)22(18)23-20(24)14-26-21(25)12-5-8-17-9-7-13-27-17/h6-7,9-11,13,15-16H,5,8,12,14H2,1-4H3,(H,23,24) |
| InChIKey | FBUGMNYQJFBBRK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |