C22H33NO3S2 — CID 7963086
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 7963086) has the molecular formula C22H33NO3S2 and a molecular weight of 423.64 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7963086 |
| Molecular Formula | C22H33NO3S2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)COC(=O)CCCC[C@H]1CCSS1 |
| InChI | InChI=1S/C22H33NO3S2/c1-15(2)18-9-7-10-19(16(3)4)22(18)23-20(24)14-26-21(25)11-6-5-8-17-12-13-27-28-17/h7,9-10,15-17H,5-6,8,11-14H2,1-4H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | OGYBTUFYCJYUMT-KRWDZBQOSA-N |
| XLogP | 6.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|