C18H24N2O5S2 — CID 7963019
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 7963019) has the molecular formula C18H24N2O5S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7963019 |
| Molecular Formula | C18H24N2O5S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)COC(=O)CCCC[C@H]2CCSS2)c1C |
| InChI | InChI=1S/C18H24N2O5S2/c1-12-7-8-15(20(23)24)18(13(12)2)19-16(21)11-25-17(22)6-4-3-5-14-9-10-26-27-14/h7-8,14H,3-6,9-11H2,1-2H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | VGKSSWNKFBMFEP-AWEZNQCLSA-N |
| XLogP | 4.41 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|