C16H22N2O5S3 — CID 7963060
[2-oxo-2-(3-sulfamoylanilino)ethyl] 5-[(3R)-dithiolan-3-yl]pentanoate (PubChem CID 7963060) has the molecular formula C16H22N2O5S3 and a molecular weight of 418.56 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 5-[(3R)-dithiolan-3-yl]pentanoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 5-[(3R)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7963060 |
| Molecular Formula | C16H22N2O5S3 |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 5-[(3R)-dithiolan-3-yl]pentanoate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)CCCC[C@@H]2CCSS2)c1 |
| InChI | InChI=1S/C16H22N2O5S3/c17-26(21,22)14-6-3-4-12(10-14)18-15(19)11-23-16(20)7-2-1-5-13-8-9-24-25-13/h3-4,6,10,13H,1-2,5,7-9,11H2,(H,18,19)(H2,17,21,22)/t13-/m1/s1 |
| InChIKey | KYMCNMCWRGGQKG-CYBMUJFWSA-N |
| XLogP | 2.53 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|