C15H19N5OS2 — CID 95908828
5-[(3R)-dithiolan-3-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]pentanamide (PubChem CID 95908828) has the molecular formula C15H19N5OS2 and a molecular weight of 349.49 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 95908828 |
| Molecular Formula | C15H19N5OS2 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1CCSS1)Nc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C15H19N5OS2/c21-14(7-2-1-6-13-8-9-22-23-13)16-12-5-3-4-11(10-12)15-17-19-20-18-15/h3-5,10,13H,1-2,6-9H2,(H,16,21)(H,17,18,19,20)/t13-/m1/s1 |
| InChIKey | JZXXCHIKHIGZSF-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|