C16H19NO3S2 — CID 97045630
5-[(3R)-dithiolan-3-yl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide (PubChem CID 97045630) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide |
|---|---|
| PubChem CID | 97045630 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide |
| SMILES | O=C(CCCC[C@@H]1CCSS1)Nc1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C16H19NO3S2/c18-15(4-2-1-3-13-7-8-21-22-13)17-12-5-6-14-11(9-12)10-20-16(14)19/h5-6,9,13H,1-4,7-8,10H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | GAECVSHNSBGPMV-CYBMUJFWSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|