C17H24N2O2S2 — CID 55847390
5-(dithiolan-3-yl)-N-[4-(propanoylamino)phenyl]pentanamide (PubChem CID 55847390) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[4-(propanoylamino)phenyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[4-(propanoylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 55847390 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[4-(propanoylamino)phenyl]pentanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)CCCCC2CCSS2)cc1 |
| InChI | InChI=1S/C17H24N2O2S2/c1-2-16(20)18-13-7-9-14(10-8-13)19-17(21)6-4-3-5-15-11-12-22-23-15/h7-10,15H,2-6,11-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | HFSFKIGVDMNXPY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|