C18H28N4OS2 — CID 24646698
5-(dithiolan-3-yl)-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pentanamide (PubChem CID 24646698) has the molecular formula C18H28N4OS2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 24646698 |
| Molecular Formula | C18H28N4OS2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pentanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CCCCC3CCSS3)cn2)CC1 |
| InChI | InChI=1S/C18H28N4OS2/c1-21-9-11-22(12-10-21)17-7-6-15(14-19-17)20-18(23)5-3-2-4-16-8-13-24-25-16/h6-7,14,16H,2-5,8-13H2,1H3,(H,20,23) |
| InChIKey | FLAMTHSOKGVVPG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|