C17H20N2OS3 — CID 24648854
5-(dithiolan-3-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide (PubChem CID 24648854) has the molecular formula C17H20N2OS3 and a molecular weight of 364.56 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 24648854 |
| Molecular Formula | C17H20N2OS3 |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C17H20N2OS3/c20-16(4-2-1-3-15-9-11-22-23-15)19-14-7-5-13(6-8-14)17-18-10-12-21-17/h5-8,10,12,15H,1-4,9,11H2,(H,19,20) |
| InChIKey | XMHBMFWKKVFXCU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|