C14H15BrN2OS — CID 114014790
5-bromo-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide (PubChem CID 114014790) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-bromo-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide.
| Compound Name | 5-bromo-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 114014790 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-bromo-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide |
| SMILES | O=C(CCCCBr)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C14H15BrN2OS/c15-8-2-1-3-13(18)17-12-6-4-11(5-7-12)14-16-9-10-19-14/h4-7,9-10H,1-3,8H2,(H,17,18) |
| InChIKey | OEVNHKSXFLWHLZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|