C13H14N4O2S — CID 60926946
2-amino-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)anilino]ethyl]acetamide (PubChem CID 60926946) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)anilino]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)anilino]ethyl]acetamide |
|---|---|
| PubChem CID | 60926946 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[4-(1,3-thiazol-2-yl)anilino]ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c14-7-11(18)16-8-12(19)17-10-3-1-9(2-4-10)13-15-5-6-20-13/h1-6H,7-8,14H2,(H,16,18)(H,17,19) |
| InChIKey | GBWRDDOOBAFPFY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |