C19H17N3O3S — CID 27701577
2-[(2-phenoxyacetyl)amino]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide (PubChem CID 27701577) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[(2-phenoxyacetyl)amino]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-[(2-phenoxyacetyl)amino]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 27701577 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-[(2-phenoxyacetyl)amino]-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C19H17N3O3S/c23-17(12-21-18(24)13-25-16-4-2-1-3-5-16)22-15-8-6-14(7-9-15)19-20-10-11-26-19/h1-11H,12-13H2,(H,21,24)(H,22,23) |
| InChIKey | ZGJLXUNFSPYULT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |