C19H23N3O2S2 — CID 95044689
5-[(3S)-dithiolan-3-yl]-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide (PubChem CID 95044689) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 5-[(3S)-dithiolan-3-yl]-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide.
| Compound Name | 5-[(3S)-dithiolan-3-yl]-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 95044689 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 5-[(3S)-dithiolan-3-yl]-N-[4-(1-methylimidazole-2-carbonyl)phenyl]pentanamide |
| SMILES | Cn1ccnc1C(=O)c1ccc(NC(=O)CCCC[C@H]2CCSS2)cc1 |
| InChI | InChI=1S/C19H23N3O2S2/c1-22-12-11-20-19(22)18(24)14-6-8-15(9-7-14)21-17(23)5-3-2-4-16-10-13-25-26-16/h6-9,11-12,16H,2-5,10,13H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | CUXBYBLGUAUTDY-INIZCTEOSA-N |
| XLogP | 4.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|