C16H21BrN2O2S2 — CID 55959922
N-[2-(4-bromoanilino)-2-oxoethyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 55959922) has the molecular formula C16H21BrN2O2S2 and a molecular weight of 417.39 g/mol. Its IUPAC name is N-[2-(4-bromoanilino)-2-oxoethyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[2-(4-bromoanilino)-2-oxoethyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 55959922 |
| Molecular Formula | C16H21BrN2O2S2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N-[2-(4-bromoanilino)-2-oxoethyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H21BrN2O2S2/c17-12-5-7-13(8-6-12)19-16(21)11-18-15(20)4-2-1-3-14-9-10-22-23-14/h5-8,14H,1-4,9-11H2,(H,18,20)(H,19,21) |
| InChIKey | SMAUDBBNMTTYJH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|