C13H24N2O4S2 — CID 154463574
2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethylcarbamic acid (PubChem CID 154463574) has the molecular formula C13H24N2O4S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 154463574 |
| Molecular Formula | C13H24N2O4S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C13H24N2O4S2/c16-12(4-2-1-3-11-5-10-20-21-11)14-6-8-19-9-7-15-13(17)18/h11,15H,1-10H2,(H,14,16)(H,17,18) |
| InChIKey | IWRKOGYZTXUXGV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|