C11H21NO4S3 — CID 91864609
3-[5-(dithiolan-3-yl)pentanoylamino]propane-1-sulfonic acid (PubChem CID 91864609) has the molecular formula C11H21NO4S3 and a molecular weight of 327.49 g/mol. Its IUPAC name is 3-[5-(dithiolan-3-yl)pentanoylamino]propane-1-sulfonic acid.
| Compound Name | 3-[5-(dithiolan-3-yl)pentanoylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91864609 |
| Molecular Formula | C11H21NO4S3 |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3-[5-(dithiolan-3-yl)pentanoylamino]propane-1-sulfonic acid |
| SMILES | O=C(CCCCC1CCSS1)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C11H21NO4S3/c13-11(12-7-3-9-19(14,15)16)5-2-1-4-10-6-8-17-18-10/h10H,1-9H2,(H,12,13)(H,14,15,16) |
| InChIKey | SZYIEKXYLQGLFW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|