C14H25NO2S2 — CID 96544591
5-[(3S)-dithiolan-3-yl]-N-(oxan-4-ylmethyl)pentanamide (PubChem CID 96544591) has the molecular formula C14H25NO2S2 and a molecular weight of 303.49 g/mol. Its IUPAC name is 5-[(3S)-dithiolan-3-yl]-N-(oxan-4-ylmethyl)pentanamide.
| Compound Name | 5-[(3S)-dithiolan-3-yl]-N-(oxan-4-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 96544591 |
| Molecular Formula | C14H25NO2S2 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-[(3S)-dithiolan-3-yl]-N-(oxan-4-ylmethyl)pentanamide |
| SMILES | O=C(CCCC[C@H]1CCSS1)NCC1CCOCC1 |
| InChI | InChI=1S/C14H25NO2S2/c16-14(15-11-12-5-8-17-9-6-12)4-2-1-3-13-7-10-18-19-13/h12-13H,1-11H2,(H,15,16)/t13-/m0/s1 |
| InChIKey | RBIMQQDIXISQFX-ZDUSSCGKSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|