C15H28N2OS2 — CID 71826784
5-(dithiolan-3-yl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pentanamide (PubChem CID 71826784) has the molecular formula C15H28N2OS2 and a molecular weight of 316.54 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 71826784 |
| Molecular Formula | C15H28N2OS2 |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pentanamide |
| SMILES | CCN1CCCC1CNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C15H28N2OS2/c1-2-17-10-5-6-13(17)12-16-15(18)8-4-3-7-14-9-11-19-20-14/h13-14H,2-12H2,1H3,(H,16,18) |
| InChIKey | ROFNCWBUKFALJH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|