C32H50N2O2S2 — CID 123764895
N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123764895) has the molecular formula C32H50N2O2S2 and a molecular weight of 558.90 g/mol. Its IUPAC name is N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123764895 |
| Molecular Formula | C32H50N2O2S2 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C32H50N2O2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-31(35)33-27-28-34-32(36)25-22-21-23-30-26-29-37-38-30/h3-4,6-7,9-10,12-13,15-16,18-19,30H,2,5,8,11,14,17,20-29H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | XGDSGLREIOYHFL-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|