C36H64N4O2S2 — CID 91566970
N-[3-[4-[3-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propyl]piperazin-1-yl]propyl]octadeca-9,12,15-trienamide (PubChem CID 91566970) has the molecular formula C36H64N4O2S2 and a molecular weight of 649.07 g/mol. Its IUPAC name is N-[3-[4-[3-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propyl]piperazin-1-yl]propyl]octadeca-9,12,15-trienamide.
| Compound Name | N-[3-[4-[3-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propyl]piperazin-1-yl]propyl]octadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 91566970 |
| Molecular Formula | C36H64N4O2S2 |
| Molecular Weight | 649.07 g/mol |
| Exact Mass | 648.45 |
| IUPAC Name | N-[3-[4-[3-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propyl]piperazin-1-yl]propyl]octadeca-9,12,15-trienamide |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)NCCCN1CCN(CCCNC(=O)CCCC[C@@H]2CCSS2)CC1 |
| InChI | InChI=1S/C36H64N4O2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-35(41)37-25-19-27-39-29-31-40(32-30-39)28-20-26-38-36(42)23-18-17-21-34-24-33-43-44-34/h3-4,6-7,9-10,34H,2,5,8,11-33H2,1H3,(H,37,41)(H,38,42)/t34-/m1/s1 |
| InChIKey | KHORNEFDMDGGPD-UUWRZZSWSA-N |
| XLogP | 7.92 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.07 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|