C25H41N3O — CID 122490706
4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]piperazine-1-carboxamide (PubChem CID 122490706) has the molecular formula C25H41N3O and a molecular weight of 399.62 g/mol. Its IUPAC name is 4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]piperazine-1-carboxamide.
| Compound Name | 4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122490706 |
| Molecular Formula | C25H41N3O |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | 4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]piperazine-1-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCN1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C25H41N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27-21-23-28(24-22-27)25(26)29/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-24H2,1H3,(H2,26,29)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | NRPPJDDKHAGQKS-JLNKQSITSA-N |
| XLogP | 5.60 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|