C40H62N2O2 — CID 160981167
icosa-5,8,11,14,17-pentaenamide (PubChem CID 160981167) has the molecular formula C40H62N2O2 and a molecular weight of 602.95 g/mol. Its IUPAC name is icosa-5,8,11,14,17-pentaenamide.
| Compound Name | icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 160981167 |
| Molecular Formula | C40H62N2O2 |
| Molecular Weight | 602.95 g/mol |
| Exact Mass | 602.48 |
| IUPAC Name | icosa-5,8,11,14,17-pentaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(N)=O.CCC=CCC=CCC=CCC=CCC=CCCCC(N)=O |
| InChI | InChI=1S/2C20H31NO/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2*3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H2,21,22) |
| InChIKey | SZNNJNRRAQTMQF-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.95 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|