(5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid

C14H22O2 — CID 118863896

IUPAC(5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid
SMILESCC/C=C\C/C=C\C/C=C\CCCC(=O)O
InChIInChI=1S/C14H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h3-4,6-7,9-10H,2,5,8,11-13H2,1H3,(H,15,16)/b4-3-,7-6-,10-9-
InChIKeyOGNXSHDOHVRKCU-PDBXOOCHSA-N
MW222.33 g/mol
LogP4.10
Rot. Bonds9

About (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid

(5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid (PubChem CID 118863896) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid.

Molecular Properties

Compound Name(5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid
PubChem CID118863896
Molecular FormulaC14H22O2
Molecular Weight222.33 g/mol
Exact Mass222.16
IUPAC Name(5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid
SMILESCC/C=C\C/C=C\C/C=C\CCCC(=O)O
InChIInChI=1S/C14H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h3-4,6-7,9-10H,2,5,8,11-13H2,1H3,(H,15,16)/b4-3-,7-6-,10-9-
InChIKeyOGNXSHDOHVRKCU-PDBXOOCHSA-N
XLogP4.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.33
LogP ≤ 54.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid?
The IUPAC name of (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid (CID 118863896) is (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid.
What is the SMILES notation for (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid?
The canonical SMILES for (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid is CC/C=C\C/C=C\C/C=C\CCCC(=O)O.
What is the InChIKey of (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid?
The InChIKey is OGNXSHDOHVRKCU-PDBXOOCHSA-N. The full InChI is InChI=1S/C14H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h3-4,6-7,9-10H,2,5,8,11-13H2,1H3,(H,15,16)/b4-3-,7-6-,10-9-.
What are the key properties of (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid?
(5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid has a molecular weight of 222.33 g/mol, XLogP of 4.10, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,8Z,11Z)-tetradeca-5,8,11-trienoic acid is sourced from PubChem (CID 118863896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).