C46H66O3 — CID 154134674
tricosa-5,8,11,14,17,20-hexaenoyl tricosa-5,8,11,14,17,20-hexaenoate (PubChem CID 154134674) has the molecular formula C46H66O3 and a molecular weight of 667.03 g/mol. Its IUPAC name is tricosa-5,8,11,14,17,20-hexaenoyl tricosa-5,8,11,14,17,20-hexaenoate.
| Compound Name | tricosa-5,8,11,14,17,20-hexaenoyl tricosa-5,8,11,14,17,20-hexaenoate |
|---|---|
| PubChem CID | 154134674 |
| Molecular Formula | C46H66O3 |
| Molecular Weight | 667.03 g/mol |
| Exact Mass | 666.50 |
| IUPAC Name | tricosa-5,8,11,14,17,20-hexaenoyl tricosa-5,8,11,14,17,20-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C46H66O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-45(47)49-46(48)44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23-26,29-32,35-38H,3-4,9-10,15-16,21-22,27-28,33-34,39-44H2,1-2H3 |
| InChIKey | NJJBCUBZPPZCIF-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.03 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|