C19H30O4 — CID 174605194
carboxy (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 174605194) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is carboxy (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | carboxy (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 174605194 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | carboxy (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(=O)O |
| InChI | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)23-19(21)22/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,21,22)/b4-3-,7-6-,10-9- |
| InChIKey | JOTQECQPMURMHR-PDBXOOCHSA-N |
| XLogP | 5.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|