C27H44NO4+ — CID 118562748
[2-hydroxy-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-4-oxobutyl]-trimethylazanium (PubChem CID 118562748) has the molecular formula C27H44NO4+ and a molecular weight of 446.65 g/mol. Its IUPAC name is [2-hydroxy-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-4-oxobutyl]-trimethylazanium.
| Compound Name | [2-hydroxy-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 118562748 |
| Molecular Formula | C27H44NO4+ |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | [2-hydroxy-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-4-oxobutyl]-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(=O)CC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C27H44NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(30)32-27(31)23-25(29)24-28(2,3)4/h6-7,9-10,12-13,15-16,18-19,25,29H,5,8,11,14,17,20-24H2,1-4H3/q+1/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | SVGVXIGCXBYVGL-WMPRHZDHSA-N |
| XLogP | 5.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|