C23H41NO — CID 90687362
tricosa-7,10,18-trienamide (PubChem CID 90687362) has the molecular formula C23H41NO and a molecular weight of 347.59 g/mol. Its IUPAC name is tricosa-7,10,18-trienamide.
| Compound Name | tricosa-7,10,18-trienamide |
|---|---|
| PubChem CID | 90687362 |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | tricosa-7,10,18-trienamide |
| SMILES | CCCCC=CCCCCCCC=CCC=CCCCCCC(N)=O |
| InChI | InChI=1S/C23H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h5-6,13-14,16-17H,2-4,7-12,15,18-22H2,1H3,(H2,24,25) |
| InChIKey | QKNLJVQGGIDYGV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|