C11H19NO — CID 87669666
(2E,8Z)-undeca-2,8-dienamide (PubChem CID 87669666) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2E,8Z)-undeca-2,8-dienamide.
| Compound Name | (2E,8Z)-undeca-2,8-dienamide |
|---|---|
| PubChem CID | 87669666 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2E,8Z)-undeca-2,8-dienamide |
| SMILES | CC/C=C\CCCC/C=C/C(N)=O |
| InChI | InChI=1S/C11H19NO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h3-4,9-10H,2,5-8H2,1H3,(H2,12,13)/b4-3-,10-9+ |
| InChIKey | NRSDTZMCMYIWIV-PWGWRZEZSA-N |
| XLogP | 2.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|