About hept-2-enamide;dihydrochloride
hept-2-enamide;dihydrochloride (PubChem CID 142841404) has the molecular formula C7H15Cl2NO
and a molecular weight of 200.11 g/mol. Its IUPAC name is hept-2-enamide;dihydrochloride.
Molecular Properties
| Compound Name | hept-2-enamide;dihydrochloride |
| PubChem CID | 142841404 |
| Molecular Formula | C7H15Cl2NO |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | hept-2-enamide;dihydrochloride |
| SMILES | CCCCC=CC(N)=O.Cl.Cl |
| InChI | InChI=1S/C7H13NO.2ClH/c1-2-3-4-5-6-7(8)9;;/h5-6H,2-4H2,1H3,(H2,8,9);2*1H |
| InChIKey | QDZJJEZRLFNDIW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hept-2-enamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-2-enamide;dihydrochloride?
The IUPAC name of hept-2-enamide;dihydrochloride (CID 142841404) is hept-2-enamide;dihydrochloride.
What is the SMILES notation for hept-2-enamide;dihydrochloride?
The canonical SMILES for hept-2-enamide;dihydrochloride is CCCCC=CC(N)=O.Cl.Cl.
What is the InChIKey of hept-2-enamide;dihydrochloride?
The InChIKey is QDZJJEZRLFNDIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.2ClH/c1-2-3-4-5-6-7(8)9;;/h5-6H,2-4H2,1H3,(H2,8,9);2*1H.
What are the key properties of hept-2-enamide;dihydrochloride?
hept-2-enamide;dihydrochloride has a molecular weight of 200.11 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-2-enamide;dihydrochloride is sourced from PubChem (CID 142841404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).