C10H17NO — CID 87184515
(2E,4Z)-deca-2,4-dienamide (PubChem CID 87184515) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2E,4Z)-deca-2,4-dienamide.
| Compound Name | (2E,4Z)-deca-2,4-dienamide |
|---|---|
| PubChem CID | 87184515 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2E,4Z)-deca-2,4-dienamide |
| SMILES | CCCCC/C=C\C=C\C(N)=O |
| InChI | InChI=1S/C10H17NO/c1-2-3-4-5-6-7-8-9-10(11)12/h6-9H,2-5H2,1H3,(H2,11,12)/b7-6-,9-8+ |
| InChIKey | DYUCHOKALYJDDA-NMMTYZSQSA-N |
| XLogP | 2.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|