C20H37NO — CID 123364114
icosa-2,4-dienamide (PubChem CID 123364114) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is icosa-2,4-dienamide.
| Compound Name | icosa-2,4-dienamide |
|---|---|
| PubChem CID | 123364114 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | icosa-2,4-dienamide |
| SMILES | CCCCCCCCCCCCCCCC=CC=CC(N)=O |
| InChI | InChI=1S/C20H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h16-19H,2-15H2,1H3,(H2,21,22) |
| InChIKey | SNIUTNKNNXNVFA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|