C13H23NO — CID 163862607
trideca-2,6-dienamide (PubChem CID 163862607) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is trideca-2,6-dienamide.
| Compound Name | trideca-2,6-dienamide |
|---|---|
| PubChem CID | 163862607 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | trideca-2,6-dienamide |
| SMILES | CCCCCCC=CCCC=CC(N)=O |
| InChI | InChI=1S/C13H23NO/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h7-8,11-12H,2-6,9-10H2,1H3,(H2,14,15) |
| InChIKey | PDWIBSXEGQTYCL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|