C22H41NO — CID 91597038
docosa-2,13-dienamide (PubChem CID 91597038) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is docosa-2,13-dienamide.
| Compound Name | docosa-2,13-dienamide |
|---|---|
| PubChem CID | 91597038 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | docosa-2,13-dienamide |
| SMILES | CCCCCCCCC=CCCCCCCCCCC=CC(N)=O |
| InChI | InChI=1S/C22H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10,20-21H,2-8,11-19H2,1H3,(H2,23,24) |
| InChIKey | XNALUXWTKRQYHP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|