About nonadec-3-enamide
nonadec-3-enamide (PubChem CID 54215031) has the molecular formula C19H37NO
and a molecular weight of 295.51 g/mol. Its IUPAC name is nonadec-3-enamide.
Molecular Properties
| Compound Name | nonadec-3-enamide |
| PubChem CID | 54215031 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | nonadec-3-enamide |
| SMILES | CCCCCCCCCCCCCCCC=CCC(N)=O |
| InChI | InChI=1S/C19H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h16-17H,2-15,18H2,1H3,(H2,20,21) |
| InChIKey | PYOMSLDGQIPONT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze nonadec-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadec-3-enamide?
The IUPAC name of nonadec-3-enamide (CID 54215031) is nonadec-3-enamide.
What is the SMILES notation for nonadec-3-enamide?
The canonical SMILES for nonadec-3-enamide is CCCCCCCCCCCCCCCC=CCC(N)=O.
What is the InChIKey of nonadec-3-enamide?
The InChIKey is PYOMSLDGQIPONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h16-17H,2-15,18H2,1H3,(H2,20,21).
What are the key properties of nonadec-3-enamide?
nonadec-3-enamide has a molecular weight of 295.51 g/mol, XLogP of 5.90, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonadec-3-enamide is sourced from PubChem (CID 54215031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).