C8H13NO — CID 166513974
octa-2,7-dienamide (PubChem CID 166513974) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is octa-2,7-dienamide.
| Compound Name | octa-2,7-dienamide |
|---|---|
| PubChem CID | 166513974 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | octa-2,7-dienamide |
| SMILES | C=CCCCC=CC(N)=O |
| InChI | InChI=1S/C8H13NO/c1-2-3-4-5-6-7-8(9)10/h2,6-7H,1,3-5H2,(H2,9,10) |
| InChIKey | JNQFLGNIWRHVLI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|