C10H14N2O4 — CID 159289765
hepta-2,5-dienediamide;prop-2-enoic acid (PubChem CID 159289765) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is hepta-2,5-dienediamide;prop-2-enoic acid.
| Compound Name | hepta-2,5-dienediamide;prop-2-enoic acid |
|---|---|
| PubChem CID | 159289765 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | hepta-2,5-dienediamide;prop-2-enoic acid |
| SMILES | C=CC(=O)O.NC(=O)C=CCC=CC(N)=O |
| InChI | InChI=1S/C7H10N2O2.C3H4O2/c8-6(10)4-2-1-3-5-7(9)11;1-2-3(4)5/h2-5H,1H2,(H2,8,10)(H2,9,11);2H,1H2,(H,4,5) |
| InChIKey | KZYSJHOWKICRJK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|