C11H17N3O4 — CID 163671957
hepta-2,5-dienediamide;N-(hydroxymethyl)prop-2-enamide (PubChem CID 163671957) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is hepta-2,5-dienediamide;N-(hydroxymethyl)prop-2-enamide.
| Compound Name | hepta-2,5-dienediamide;N-(hydroxymethyl)prop-2-enamide |
|---|---|
| PubChem CID | 163671957 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | hepta-2,5-dienediamide;N-(hydroxymethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCO.NC(=O)C=CCC=CC(N)=O |
| InChI | InChI=1S/C7H10N2O2.C4H7NO2/c8-6(10)4-2-1-3-5-7(9)11;1-2-4(7)5-3-6/h2-5H,1H2,(H2,8,10)(H2,9,11);2,6H,1,3H2,(H,5,7) |
| InChIKey | JDIIQJUYVSSJOF-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|