C19H32N4O5 — CID 86615607
2-aminoethyl 2-methylprop-2-enoate;hepta-2,5-dienediamide;N-propan-2-ylprop-2-enamide (PubChem CID 86615607) has the molecular formula C19H32N4O5 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-aminoethyl 2-methylprop-2-enoate;hepta-2,5-dienediamide;N-propan-2-ylprop-2-enamide.
| Compound Name | 2-aminoethyl 2-methylprop-2-enoate;hepta-2,5-dienediamide;N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 86615607 |
| Molecular Formula | C19H32N4O5 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-aminoethyl 2-methylprop-2-enoate;hepta-2,5-dienediamide;N-propan-2-ylprop-2-enamide |
| SMILES | C=C(C)C(=O)OCCN.C=CC(=O)NC(C)C.NC(=O)C=CCC=CC(N)=O |
| InChI | InChI=1S/C7H10N2O2.C6H11NO2.C6H11NO/c8-6(10)4-2-1-3-5-7(9)11;1-5(2)6(8)9-4-3-7;1-4-6(8)7-5(2)3/h2-5H,1H2,(H2,8,10)(H2,9,11);1,3-4,7H2,2H3;4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | KGVULBZTZPKBFS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 167.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|