C9H15N3O3 — CID 174662620
acetamide;hepta-2,5-dienediamide (PubChem CID 174662620) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is acetamide;hepta-2,5-dienediamide.
| Compound Name | acetamide;hepta-2,5-dienediamide |
|---|---|
| PubChem CID | 174662620 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | acetamide;hepta-2,5-dienediamide |
| SMILES | CC(N)=O.NC(=O)C=CCC=CC(N)=O |
| InChI | InChI=1S/C7H10N2O2.C2H5NO/c8-6(10)4-2-1-3-5-7(9)11;1-2(3)4/h2-5H,1H2,(H2,8,10)(H2,9,11);1H3,(H2,3,4) |
| InChIKey | BOBIPARZBSSOBX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|