About acetamide;rhodium(2+)
acetamide;rhodium(2+) (PubChem CID 159449063) has the molecular formula C2H5NORh+2
and a molecular weight of 161.97 g/mol. Its IUPAC name is acetamide;rhodium(2+).
Molecular Properties
| Compound Name | acetamide;rhodium(2+) |
| PubChem CID | 159449063 |
| Molecular Formula | C2H5NORh+2 |
| Molecular Weight | 161.97 g/mol |
| Exact Mass | 161.94 |
| IUPAC Name | acetamide;rhodium(2+) |
| SMILES | CC(N)=O.[Rh+2] |
| InChI | InChI=1S/C2H5NO.Rh/c1-2(3)4;/h1H3,(H2,3,4);/q;+2 |
| InChIKey | LTCYNBZVLLZXHC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.97 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide;rhodium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;rhodium(2+)?
The IUPAC name of acetamide;rhodium(2+) (CID 159449063) is acetamide;rhodium(2+).
What is the SMILES notation for acetamide;rhodium(2+)?
The canonical SMILES for acetamide;rhodium(2+) is CC(N)=O.[Rh+2].
What is the InChIKey of acetamide;rhodium(2+)?
The InChIKey is LTCYNBZVLLZXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO.Rh/c1-2(3)4;/h1H3,(H2,3,4);/q;+2.
What are the key properties of acetamide;rhodium(2+)?
acetamide;rhodium(2+) has a molecular weight of 161.97 g/mol, XLogP of -0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;rhodium(2+) is sourced from PubChem (CID 159449063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).