About acetamide;bismuthane
acetamide;bismuthane (PubChem CID 174469104) has the molecular formula C2H8BiNO
and a molecular weight of 271.07 g/mol. Its IUPAC name is acetamide;bismuthane.
Molecular Properties
| Compound Name | acetamide;bismuthane |
| PubChem CID | 174469104 |
| Molecular Formula | C2H8BiNO |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | acetamide;bismuthane |
| SMILES | CC(N)=O.[BiH3] |
| InChI | InChI=1S/C2H5NO.Bi.3H/c1-2(3)4;;;;/h1H3,(H2,3,4);;;; |
| InChIKey | BOXQWGYHKZEGGS-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide;bismuthane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;bismuthane?
The IUPAC name of acetamide;bismuthane (CID 174469104) is acetamide;bismuthane.
What is the SMILES notation for acetamide;bismuthane?
The canonical SMILES for acetamide;bismuthane is CC(N)=O.[BiH3].
What is the InChIKey of acetamide;bismuthane?
The InChIKey is BOXQWGYHKZEGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO.Bi.3H/c1-2(3)4;;;;/h1H3,(H2,3,4);;;;.
What are the key properties of acetamide;bismuthane?
acetamide;bismuthane has a molecular weight of 271.07 g/mol, XLogP of -1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;bismuthane is sourced from PubChem (CID 174469104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).