About acetamide;formic acid
acetamide;formic acid (PubChem CID 19762194) has the molecular formula C3H7NO3
and a molecular weight of 105.09 g/mol. Its IUPAC name is acetamide;formic acid.
Molecular Properties
| Compound Name | acetamide;formic acid |
| PubChem CID | 19762194 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | acetamide;formic acid |
| SMILES | CC(N)=O.O=CO |
| InChI | InChI=1S/C2H5NO.CH2O2/c1-2(3)4;2-1-3/h1H3,(H2,3,4);1H,(H,2,3) |
| InChIKey | AAQLWZRNSJGQGC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetamide;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;formic acid?
The IUPAC name of acetamide;formic acid (CID 19762194) is acetamide;formic acid.
What is the SMILES notation for acetamide;formic acid?
The canonical SMILES for acetamide;formic acid is CC(N)=O.O=CO.
What is the InChIKey of acetamide;formic acid?
The InChIKey is AAQLWZRNSJGQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO.CH2O2/c1-2(3)4;2-1-3/h1H3,(H2,3,4);1H,(H,2,3).
What are the key properties of acetamide;formic acid?
acetamide;formic acid has a molecular weight of 105.09 g/mol, XLogP of -0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;formic acid is sourced from PubChem (CID 19762194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).