About acetamide;alumane
acetamide;alumane (PubChem CID 174673000) has the molecular formula C2H8AlNO
and a molecular weight of 89.07 g/mol. Its IUPAC name is acetamide;alumane.
Molecular Properties
| Compound Name | acetamide;alumane |
| PubChem CID | 174673000 |
| Molecular Formula | C2H8AlNO |
| Molecular Weight | 89.07 g/mol |
| Exact Mass | 89.04 |
| IUPAC Name | acetamide;alumane |
| SMILES | CC(N)=O.[AlH3] |
| InChI | InChI=1S/C2H5NO.Al.3H/c1-2(3)4;;;;/h1H3,(H2,3,4);;;; |
| InChIKey | MCNAQHSIHRRAFN-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.07 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide;alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;alumane?
The IUPAC name of acetamide;alumane (CID 174673000) is acetamide;alumane.
What is the SMILES notation for acetamide;alumane?
The canonical SMILES for acetamide;alumane is CC(N)=O.[AlH3].
What is the InChIKey of acetamide;alumane?
The InChIKey is MCNAQHSIHRRAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO.Al.3H/c1-2(3)4;;;;/h1H3,(H2,3,4);;;;.
What are the key properties of acetamide;alumane?
acetamide;alumane has a molecular weight of 89.07 g/mol, XLogP of -1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;alumane is sourced from PubChem (CID 174673000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).