About acetamide;trimethylsilane
acetamide;trimethylsilane (PubChem CID 158076897) has the molecular formula C9H25N3O3Si
and a molecular weight of 251.40 g/mol. Its IUPAC name is acetamide;trimethylsilane.
Molecular Properties
| Compound Name | acetamide;trimethylsilane |
| PubChem CID | 158076897 |
| Molecular Formula | C9H25N3O3Si |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | acetamide;trimethylsilane |
| SMILES | CC(N)=O.CC(N)=O.CC(N)=O.C[SiH](C)C |
| InChI | InChI=1S/C3H10Si.3C2H5NO/c1-4(2)3;3*1-2(3)4/h4H,1-3H3;3*1H3,(H2,3,4) |
| InChIKey | FMMDPWPLRLWGBJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetamide;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;trimethylsilane?
The IUPAC name of acetamide;trimethylsilane (CID 158076897) is acetamide;trimethylsilane.
What is the SMILES notation for acetamide;trimethylsilane?
The canonical SMILES for acetamide;trimethylsilane is CC(N)=O.CC(N)=O.CC(N)=O.C[SiH](C)C.
What is the InChIKey of acetamide;trimethylsilane?
The InChIKey is FMMDPWPLRLWGBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.3C2H5NO/c1-4(2)3;3*1-2(3)4/h4H,1-3H3;3*1H3,(H2,3,4).
What are the key properties of acetamide;trimethylsilane?
acetamide;trimethylsilane has a molecular weight of 251.40 g/mol, XLogP of -0.42, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;trimethylsilane is sourced from PubChem (CID 158076897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).